C26H30N4O2S — CID 166381990
3-[(1-benzylpiperidin-2-yl)methylcarbamoylamino]-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 166381990) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is 3-[(1-benzylpiperidin-2-yl)methylcarbamoylamino]-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-[(1-benzylpiperidin-2-yl)methylcarbamoylamino]-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 166381990 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 3-[(1-benzylpiperidin-2-yl)methylcarbamoylamino]-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCCN1Cc1ccccc1)Nc1cccc(C(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C26H30N4O2S/c31-25(27-18-24-13-7-15-33-24)21-10-6-11-22(16-21)29-26(32)28-17-23-12-4-5-14-30(23)19-20-8-2-1-3-9-20/h1-3,6-11,13,15-16,23H,4-5,12,14,17-19H2,(H,27,31)(H2,28,29,32) |
| InChIKey | HVZYQPDNUKFIIQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |