C21H28N4O2S — CID 71897626
2-[2-[(phenylcarbamoylamino)methyl]piperidin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 71897626) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-[2-[(phenylcarbamoylamino)methyl]piperidin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[2-[(phenylcarbamoylamino)methyl]piperidin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 71897626 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[2-[(phenylcarbamoylamino)methyl]piperidin-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(CN1CCCCC1CNC(=O)Nc1ccccc1)NCCc1cccs1 |
| InChI | InChI=1S/C21H28N4O2S/c26-20(22-12-11-19-10-6-14-28-19)16-25-13-5-4-9-18(25)15-23-21(27)24-17-7-2-1-3-8-17/h1-3,6-8,10,14,18H,4-5,9,11-13,15-16H2,(H,22,26)(H2,23,24,27) |
| InChIKey | VZYZLICLAKJXKV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |