C22H28N4O4S — CID 42956011
N-(3-methylsulfonylphenyl)-2-[2-[(phenylcarbamoylamino)methyl]piperidin-1-yl]acetamide (PubChem CID 42956011) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-(3-methylsulfonylphenyl)-2-[2-[(phenylcarbamoylamino)methyl]piperidin-1-yl]acetamide.
| Compound Name | N-(3-methylsulfonylphenyl)-2-[2-[(phenylcarbamoylamino)methyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 42956011 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-(3-methylsulfonylphenyl)-2-[2-[(phenylcarbamoylamino)methyl]piperidin-1-yl]acetamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)CN2CCCCC2CNC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C22H28N4O4S/c1-31(29,30)20-12-7-10-18(14-20)24-21(27)16-26-13-6-5-11-19(26)15-23-22(28)25-17-8-3-2-4-9-17/h2-4,7-10,12,14,19H,5-6,11,13,15-16H2,1H3,(H,24,27)(H2,23,25,28) |
| InChIKey | LRLHLBOHZHVJIS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |