C18H24N4O — CID 166382908
4-N-(3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-2-N,6-dimethylpyrimidine-2,4-diamine (PubChem CID 166382908) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-N-(3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-2-N,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-2-N,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166382908 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 4-N-(3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-2-N,6-dimethylpyrimidine-2,4-diamine |
| SMILES | CNc1nc(C)cc(NC2CCCc3ccc(OC)cc3C2)n1 |
| InChI | InChI=1S/C18H24N4O/c1-12-9-17(22-18(19-2)20-12)21-15-6-4-5-13-7-8-16(23-3)11-14(13)10-15/h7-9,11,15H,4-6,10H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | SWHNFKIPWCWALP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |