C19H30N2O — CID 166384244
N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide (PubChem CID 166384244) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide.
| Compound Name | N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide |
|---|---|
| PubChem CID | 166384244 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide |
| SMILES | CCCC(CCC)CC(=O)NCC1c2ccccc2CN1C |
| InChI | InChI=1S/C19H30N2O/c1-4-8-15(9-5-2)12-19(22)20-13-18-17-11-7-6-10-16(17)14-21(18)3/h6-7,10-11,15,18H,4-5,8-9,12-14H2,1-3H3,(H,20,22) |
| InChIKey | ZTQVAHFMLXVHEO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |