About N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide
N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide (PubChem CID 166384244) has the molecular formula C19H30N2O
and a molecular weight of 302.46 g/mol. Its IUPAC name is N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide.
Molecular Properties
| Compound Name | N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide |
| PubChem CID | 166384244 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide |
| SMILES | CCCC(CCC)CC(=O)NCC1c2ccccc2CN1C |
| InChI | InChI=1S/C19H30N2O/c1-4-8-15(9-5-2)12-19(22)20-13-18-17-11-7-6-10-16(17)14-21(18)3/h6-7,10-11,15,18H,4-5,8-9,12-14H2,1-3H3,(H,20,22) |
| InChIKey | ZTQVAHFMLXVHEO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide?
The IUPAC name of N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide (CID 166384244) is N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide.
What is the SMILES notation for N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide?
The canonical SMILES for N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide is CCCC(CCC)CC(=O)NCC1c2ccccc2CN1C.
What is the InChIKey of N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide?
The InChIKey is ZTQVAHFMLXVHEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O/c1-4-8-15(9-5-2)12-19(22)20-13-18-17-11-7-6-10-16(17)14-21(18)3/h6-7,10-11,15,18H,4-5,8-9,12-14H2,1-3H3,(H,20,22).
What are the key properties of N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide?
N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide has a molecular weight of 302.46 g/mol, XLogP of 3.90, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methyl-1,3-dihydroisoindol-1-yl)methyl]-3-propylhexanamide is sourced from PubChem (CID 166384244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).