C19H23N3 — CID 166384633
2-(cyclopropylmethyl)-N-[(4-cyclopropyl-3-methylphenyl)methyl]pyrimidin-5-amine (PubChem CID 166384633) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-N-[(4-cyclopropyl-3-methylphenyl)methyl]pyrimidin-5-amine.
| Compound Name | 2-(cyclopropylmethyl)-N-[(4-cyclopropyl-3-methylphenyl)methyl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 166384633 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-(cyclopropylmethyl)-N-[(4-cyclopropyl-3-methylphenyl)methyl]pyrimidin-5-amine |
| SMILES | Cc1cc(CNc2cnc(CC3CC3)nc2)ccc1C1CC1 |
| InChI | InChI=1S/C19H23N3/c1-13-8-15(4-7-18(13)16-5-6-16)10-20-17-11-21-19(22-12-17)9-14-2-3-14/h4,7-8,11-12,14,16,20H,2-3,5-6,9-10H2,1H3 |
| InChIKey | CDTNWWJZDMQLCK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |