C18H17N3O3S — CID 166384915
4-[(3-phenoxyphenyl)methylamino]pyridine-2-sulfonamide (PubChem CID 166384915) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-[(3-phenoxyphenyl)methylamino]pyridine-2-sulfonamide.
| Compound Name | 4-[(3-phenoxyphenyl)methylamino]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 166384915 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 4-[(3-phenoxyphenyl)methylamino]pyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(NCc2cccc(Oc3ccccc3)c2)ccn1 |
| InChI | InChI=1S/C18H17N3O3S/c19-25(22,23)18-12-15(9-10-20-18)21-13-14-5-4-8-17(11-14)24-16-6-2-1-3-7-16/h1-12H,13H2,(H,20,21)(H2,19,22,23) |
| InChIKey | MNQJDVYGRKWJJQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |