C15H22N2O5 — CID 16638515
8-O-tert-butyl 3-O-prop-2-enyl 2-oxo-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate (PubChem CID 16638515) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 8-O-tert-butyl 3-O-prop-2-enyl 2-oxo-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 3-O-prop-2-enyl 2-oxo-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate |
|---|---|
| PubChem CID | 16638515 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 8-O-tert-butyl 3-O-prop-2-enyl 2-oxo-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate |
| SMILES | C=CCOC(=O)N1CC2CCC(C1=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N2O5/c1-5-8-21-13(19)16-9-10-6-7-11(12(16)18)17(10)14(20)22-15(2,3)4/h5,10-11H,1,6-9H2,2-4H3 |
| InChIKey | SULUWWZOXZRSNO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|