C16H20N4O2 — CID 166385302
1-(2,4-dimethylphenyl)-5-oxo-N-[(3S)-pyrrolidin-3-yl]-4H-pyrazole-3-carboxamide (PubChem CID 166385302) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-5-oxo-N-[(3S)-pyrrolidin-3-yl]-4H-pyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dimethylphenyl)-5-oxo-N-[(3S)-pyrrolidin-3-yl]-4H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166385302 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-5-oxo-N-[(3S)-pyrrolidin-3-yl]-4H-pyrazole-3-carboxamide |
| SMILES | Cc1ccc(N2N=C(C(=O)N[C@H]3CCNC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C16H20N4O2/c1-10-3-4-14(11(2)7-10)20-15(21)8-13(19-20)16(22)18-12-5-6-17-9-12/h3-4,7,12,17H,5-6,8-9H2,1-2H3,(H,18,22)/t12-/m0/s1 |
| InChIKey | XZNOQQKHDGWNLP-LBPRGKRZSA-N |
| XLogP | 0.87 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'} |
|---|