C12H14N2O — CID 1227222
2-(2,4-dimethylphenyl)-5-methyl-4H-pyrazol-3-one (PubChem CID 1227222) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-5-methyl-4H-pyrazol-3-one.
| Compound Name | 2-(2,4-dimethylphenyl)-5-methyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 1227222 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-5-methyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(C)cc2C)C(=O)C1 |
| InChI | InChI=1S/C12H14N2O/c1-8-4-5-11(9(2)6-8)14-12(15)7-10(3)13-14/h4-6H,7H2,1-3H3 |
| InChIKey | AEISAVPOAWUOEY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |