About 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride
2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride (PubChem CID 74892069) has the molecular formula C10H15Cl2N3O2
and a molecular weight of 280.16 g/mol. Its IUPAC name is 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride |
| PubChem CID | 74892069 |
| Molecular Formula | C10H15Cl2N3O2 |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride |
| SMILES | CC1=NN(c2ccc(N)cc2)C(=O)C1.Cl.Cl.O |
| InChI | InChI=1S/C10H11N3O.2ClH.H2O/c1-7-6-10(14)13(12-7)9-4-2-8(11)3-5-9;;;/h2-5H,6,11H2,1H3;2*1H;1H2 |
| InChIKey | WLDOUBGHMIKCPS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride?
The IUPAC name of 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride (CID 74892069) is 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride.
What is the SMILES notation for 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride?
The canonical SMILES for 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride is CC1=NN(c2ccc(N)cc2)C(=O)C1.Cl.Cl.O.
What is the InChIKey of 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride?
The InChIKey is WLDOUBGHMIKCPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O.2ClH.H2O/c1-7-6-10(14)13(12-7)9-4-2-8(11)3-5-9;;;/h2-5H,6,11H2,1H3;2*1H;1H2.
What are the key properties of 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride?
2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride has a molecular weight of 280.16 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminophenyl)-5-methyl-4H-pyrazol-3-one;hydrate;dihydrochloride is sourced from PubChem (CID 74892069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).