C10H11N3O6S — CID 141082764
4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid (PubChem CID 141082764) has the molecular formula C10H11N3O6S and a molecular weight of 301.28 g/mol. Its IUPAC name is 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid.
| Compound Name | 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid |
|---|---|
| PubChem CID | 141082764 |
| Molecular Formula | C10H11N3O6S |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid |
| SMILES | CC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1.O=NO |
| InChI | InChI=1S/C10H10N2O4S.HNO2/c1-7-6-10(13)12(11-7)8-2-4-9(5-3-8)17(14,15)16;2-1-3/h2-5H,6H2,1H3,(H,14,15,16);(H,2,3) |
| InChIKey | VILKJWLKAJOLJQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|