4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid

C10H11N3O6S — CID 141082764

IUPAC4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid
SMILESCC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1.O=NO
InChIInChI=1S/C10H10N2O4S.HNO2/c1-7-6-10(13)12(11-7)8-2-4-9(5-3-8)17(14,15)16;2-1-3/h2-5H,6H2,1H3,(H,14,15,16);(H,2,3)
InChIKeyVILKJWLKAJOLJQ-UHFFFAOYSA-N
MW301.28 g/mol
LogP1.19
Rot. Bonds2

About 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid

4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid (PubChem CID 141082764) has the molecular formula C10H11N3O6S and a molecular weight of 301.28 g/mol. Its IUPAC name is 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid.

Molecular Properties

Compound Name4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid
PubChem CID141082764
Molecular FormulaC10H11N3O6S
Molecular Weight301.28 g/mol
Exact Mass301.04
IUPAC Name4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid
SMILESCC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1.O=NO
InChIInChI=1S/C10H10N2O4S.HNO2/c1-7-6-10(13)12(11-7)8-2-4-9(5-3-8)17(14,15)16;2-1-3/h2-5H,6H2,1H3,(H,14,15,16);(H,2,3)
InChIKeyVILKJWLKAJOLJQ-UHFFFAOYSA-N
XLogP1.19
TPSA136.70 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.28
LogP ≤ 51.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid?
The IUPAC name of 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid (CID 141082764) is 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid.
What is the SMILES notation for 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid?
The canonical SMILES for 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid is CC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1.O=NO.
What is the InChIKey of 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid?
The InChIKey is VILKJWLKAJOLJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O4S.HNO2/c1-7-6-10(13)12(11-7)8-2-4-9(5-3-8)17(14,15)16;2-1-3/h2-5H,6H2,1H3,(H,14,15,16);(H,2,3).
What are the key properties of 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid?
4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid has a molecular weight of 301.28 g/mol, XLogP of 1.19, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid;nitrous acid is sourced from PubChem (CID 141082764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).