C14H19N3O5S — CID 71148800
N,N-bis(1-hydroxyethyl)-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonamide (PubChem CID 71148800) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is N,N-bis(1-hydroxyethyl)-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonamide.
| Compound Name | N,N-bis(1-hydroxyethyl)-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71148800 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N,N-bis(1-hydroxyethyl)-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonamide |
| SMILES | CC1=NN(c2ccc(S(=O)(=O)N(C(C)O)C(C)O)cc2)C(=O)C1 |
| InChI | InChI=1S/C14H19N3O5S/c1-9-8-14(20)16(15-9)12-4-6-13(7-5-12)23(21,22)17(10(2)18)11(3)19/h4-7,10-11,18-19H,8H2,1-3H3 |
| InChIKey | COOWIELNOARBLL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|