C15H12N4O2S — CID 166385617
2-(4-methylsulfonylphenyl)-3,5-dihydroimidazo[4,5-f]benzimidazole (PubChem CID 166385617) has the molecular formula C15H12N4O2S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-3,5-dihydroimidazo[4,5-f]benzimidazole.
| Compound Name | 2-(4-methylsulfonylphenyl)-3,5-dihydroimidazo[4,5-f]benzimidazole |
|---|---|
| PubChem CID | 166385617 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-3,5-dihydroimidazo[4,5-f]benzimidazole |
| SMILES | CS(=O)(=O)c1ccc(-c2nc3cc4nc[nH]c4cc3[nH]2)cc1 |
| InChI | InChI=1S/C15H12N4O2S/c1-22(20,21)10-4-2-9(3-5-10)15-18-13-6-11-12(17-8-16-11)7-14(13)19-15/h2-8H,1H3,(H,16,17)(H,18,19) |
| InChIKey | NQFVNMJMKXZAAC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |