C10H10F3N3O3 — CID 166385998
N-[2-oxo-2-[2-[2-(trifluoromethoxy)phenyl]hydrazinyl]ethyl]formamide (PubChem CID 166385998) has the molecular formula C10H10F3N3O3 and a molecular weight of 277.20 g/mol. Its IUPAC name is N-[2-oxo-2-[2-[2-(trifluoromethoxy)phenyl]hydrazinyl]ethyl]formamide.
| Compound Name | N-[2-oxo-2-[2-[2-(trifluoromethoxy)phenyl]hydrazinyl]ethyl]formamide |
|---|---|
| PubChem CID | 166385998 |
| Molecular Formula | C10H10F3N3O3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-[2-oxo-2-[2-[2-(trifluoromethoxy)phenyl]hydrazinyl]ethyl]formamide |
| SMILES | O=CNCC(=O)NNc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C10H10F3N3O3/c11-10(12,13)19-8-4-2-1-3-7(8)15-16-9(18)5-14-6-17/h1-4,6,15H,5H2,(H,14,17)(H,16,18) |
| InChIKey | ASFXTCNJGKEYCA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|