About [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate
[1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate (PubChem CID 166386432) has the molecular formula C12H14N6O3
and a molecular weight of 290.28 g/mol. Its IUPAC name is [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate |
| PubChem CID | 166386432 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate |
| SMILES | CC(OC(=O)Nc1ccccc1)C(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C12H14N6O3/c1-8(11(19)13-7-10-15-17-18-16-10)21-12(20)14-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,13,19)(H,14,20)(H,15,16,17,18) |
| InChIKey | QIUOHWMDCMBNRO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate?
The IUPAC name of [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate (CID 166386432) is [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate.
What is the SMILES notation for [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate?
The canonical SMILES for [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate is CC(OC(=O)Nc1ccccc1)C(=O)NCc1nn[nH]n1.
What is the InChIKey of [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate?
The InChIKey is QIUOHWMDCMBNRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N6O3/c1-8(11(19)13-7-10-15-17-18-16-10)21-12(20)14-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,13,19)(H,14,20)(H,15,16,17,18).
What are the key properties of [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate?
[1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate has a molecular weight of 290.28 g/mol, XLogP of 0.45, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-oxo-1-(2H-tetrazol-5-ylmethylamino)propan-2-yl] N-phenylcarbamate is sourced from PubChem (CID 166386432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).