C16H14N2O5S — CID 166386603
3-[4-(1,2-benzoxazol-5-ylsulfonylamino)phenyl]propanoic acid (PubChem CID 166386603) has the molecular formula C16H14N2O5S and a molecular weight of 346.36 g/mol. Its IUPAC name is 3-[4-(1,2-benzoxazol-5-ylsulfonylamino)phenyl]propanoic acid.
| Compound Name | 3-[4-(1,2-benzoxazol-5-ylsulfonylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 166386603 |
| Molecular Formula | C16H14N2O5S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 3-[4-(1,2-benzoxazol-5-ylsulfonylamino)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(NS(=O)(=O)c2ccc3oncc3c2)cc1 |
| InChI | InChI=1S/C16H14N2O5S/c19-16(20)8-3-11-1-4-13(5-2-11)18-24(21,22)14-6-7-15-12(9-14)10-17-23-15/h1-2,4-7,9-10,18H,3,8H2,(H,19,20) |
| InChIKey | MQNWYDAUGBSXMB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |