C21H17NO5S — CID 9235437
3-[4-(dibenzofuran-2-ylsulfamoyl)phenyl]propanoic acid (PubChem CID 9235437) has the molecular formula C21H17NO5S and a molecular weight of 395.44 g/mol. Its IUPAC name is 3-[4-(dibenzofuran-2-ylsulfamoyl)phenyl]propanoic acid.
| Compound Name | 3-[4-(dibenzofuran-2-ylsulfamoyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 9235437 |
| Molecular Formula | C21H17NO5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 3-[4-(dibenzofuran-2-ylsulfamoyl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(S(=O)(=O)Nc2ccc3oc4ccccc4c3c2)cc1 |
| InChI | InChI=1S/C21H17NO5S/c23-21(24)12-7-14-5-9-16(10-6-14)28(25,26)22-15-8-11-20-18(13-15)17-3-1-2-4-19(17)27-20/h1-6,8-11,13,22H,7,12H2,(H,23,24) |
| InChIKey | UATLBZZYQUFUBQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |