C17H23ClN2O3 — CID 166390357
cis-(1R,2S)-2-N-(4-chlorophenyl)-1-N-(3-hydroxypropyl)cyclohexane-1,2-dicarboxamide (PubChem CID 166390357) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is cis-(1R,2S)-2-N-(4-chlorophenyl)-1-N-(3-hydroxypropyl)cyclohexane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-2-N-(4-chlorophenyl)-1-N-(3-hydroxypropyl)cyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 166390357 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | cis-(1R,2S)-2-N-(4-chlorophenyl)-1-N-(3-hydroxypropyl)cyclohexane-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)[C@H]1CCCC[C@H]1C(=O)NCCCO |
| InChI | InChI=1S/C17H23ClN2O3/c18-12-6-8-13(9-7-12)20-17(23)15-5-2-1-4-14(15)16(22)19-10-3-11-21/h6-9,14-15,21H,1-5,10-11H2,(H,19,22)(H,20,23)/t14-,15+/m1/s1 |
| InChIKey | UJGYKZJQQVGEJJ-CABCVRRESA-N |
| XLogP | 2.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|