C13H20N6O3S — CID 166394145
N-(5-piperazin-1-yl-2-pyridinyl)-1-sulfamoylazetidine-3-carboxamide (PubChem CID 166394145) has the molecular formula C13H20N6O3S and a molecular weight of 340.41 g/mol. Its IUPAC name is N-(5-piperazin-1-yl-2-pyridinyl)-1-sulfamoylazetidine-3-carboxamide.
| Compound Name | N-(5-piperazin-1-yl-2-pyridinyl)-1-sulfamoylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 166394145 |
| Molecular Formula | C13H20N6O3S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-(5-piperazin-1-yl-2-pyridinyl)-1-sulfamoylazetidine-3-carboxamide |
| SMILES | NS(=O)(=O)N1CC(C(=O)Nc2ccc(N3CCNCC3)cn2)C1 |
| InChI | InChI=1S/C13H20N6O3S/c14-23(21,22)19-8-10(9-19)13(20)17-12-2-1-11(7-16-12)18-5-3-15-4-6-18/h1-2,7,10,15H,3-6,8-9H2,(H2,14,21,22)(H,16,17,20) |
| InChIKey | LODMHJTULPPWRE-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |