C19H18ClFN4O3 — CID 166396855
3-N-[(E)-4-[(3-amino-4-chlorobenzoyl)amino]but-2-enyl]-5-fluorobenzene-1,3-dicarboxamide (PubChem CID 166396855) has the molecular formula C19H18ClFN4O3 and a molecular weight of 404.83 g/mol. Its IUPAC name is 3-N-[(E)-4-[(3-amino-4-chlorobenzoyl)amino]but-2-enyl]-5-fluorobenzene-1,3-dicarboxamide.
| Compound Name | 3-N-[(E)-4-[(3-amino-4-chlorobenzoyl)amino]but-2-enyl]-5-fluorobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 166396855 |
| Molecular Formula | C19H18ClFN4O3 |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 3-N-[(E)-4-[(3-amino-4-chlorobenzoyl)amino]but-2-enyl]-5-fluorobenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(F)cc(C(=O)NC/C=C/CNC(=O)c2ccc(Cl)c(N)c2)c1 |
| InChI | InChI=1S/C19H18ClFN4O3/c20-15-4-3-11(10-16(15)22)18(27)24-5-1-2-6-25-19(28)13-7-12(17(23)26)8-14(21)9-13/h1-4,7-10H,5-6,22H2,(H2,23,26)(H,24,27)(H,25,28)/b2-1+ |
| InChIKey | HAYANVLGDWAUBA-OWOJBTEDSA-N |
| XLogP | 1.88 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|