C23H32N2O3 — CID 166397440
N-[[1-(3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-carbonyl)azetidin-2-yl]methyl]-2-(3,5-dimethylphenyl)acetamide (PubChem CID 166397440) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[[1-(3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-carbonyl)azetidin-2-yl]methyl]-2-(3,5-dimethylphenyl)acetamide.
| Compound Name | N-[[1-(3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-carbonyl)azetidin-2-yl]methyl]-2-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 166397440 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[[1-(3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-carbonyl)azetidin-2-yl]methyl]-2-(3,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(C)cc(CC(=O)NCC2CCN2C(=O)C23CCCCC2OCC3)c1 |
| InChI | InChI=1S/C23H32N2O3/c1-16-11-17(2)13-18(12-16)14-21(26)24-15-19-6-9-25(19)22(27)23-7-4-3-5-20(23)28-10-8-23/h11-13,19-20H,3-10,14-15H2,1-2H3,(H,24,26) |
| InChIKey | DLEFFRCIWLMYEU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |