About 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide
5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide (PubChem CID 166400344) has the molecular formula C22H24N4O2
and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide.
Molecular Properties
| Compound Name | 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide |
| PubChem CID | 166400344 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide |
| SMILES | Cc1ccc(-c2cn([C@@H]3CCCC[C@H]3O)nn2)cc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H24N4O2/c1-15-11-12-16(13-18(15)22(28)23-17-7-3-2-4-8-17)19-14-26(25-24-19)20-9-5-6-10-21(20)27/h2-4,7-8,11-14,20-21,27H,5-6,9-10H2,1H3,(H,23,28)/t20-,21-/m1/s1 |
| InChIKey | GKHLBMYGHXJUPM-NHCUHLMSSA-N |
| XLogP | 3.98 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide?
The IUPAC name of 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide (CID 166400344) is 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide.
What is the SMILES notation for 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide?
The canonical SMILES for 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide is Cc1ccc(-c2cn([C@@H]3CCCC[C@H]3O)nn2)cc1C(=O)Nc1ccccc1.
What is the InChIKey of 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide?
The InChIKey is GKHLBMYGHXJUPM-NHCUHLMSSA-N. The full InChI is InChI=1S/C22H24N4O2/c1-15-11-12-16(13-18(15)22(28)23-17-7-3-2-4-8-17)19-14-26(25-24-19)20-9-5-6-10-21(20)27/h2-4,7-8,11-14,20-21,27H,5-6,9-10H2,1H3,(H,23,28)/t20-,21-/m1/s1.
What are the key properties of 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide?
5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide has a molecular weight of 376.46 g/mol, XLogP of 3.98, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[(1R,2R)-2-hydroxycyclohexyl]triazol-4-yl]-2-methyl-N-phenylbenzamide is sourced from PubChem (CID 166400344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).