C21H23N5O2 — CID 167977083
5-[1-[(2S)-1-acetamidopropan-2-yl]triazol-4-yl]-2-methyl-N-phenylbenzamide (PubChem CID 167977083) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 5-[1-[(2S)-1-acetamidopropan-2-yl]triazol-4-yl]-2-methyl-N-phenylbenzamide.
| Compound Name | 5-[1-[(2S)-1-acetamidopropan-2-yl]triazol-4-yl]-2-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 167977083 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 5-[1-[(2S)-1-acetamidopropan-2-yl]triazol-4-yl]-2-methyl-N-phenylbenzamide |
| SMILES | CC(=O)NC[C@H](C)n1cc(-c2ccc(C)c(C(=O)Nc3ccccc3)c2)nn1 |
| InChI | InChI=1S/C21H23N5O2/c1-14-9-10-17(11-19(14)21(28)23-18-7-5-4-6-8-18)20-13-26(25-24-20)15(2)12-22-16(3)27/h4-11,13,15H,12H2,1-3H3,(H,22,27)(H,23,28)/t15-/m0/s1 |
| InChIKey | BFJBJNUJBNBRSV-HNNXBMFYSA-N |
| XLogP | 3.20 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |