C19H23N5O5 — CID 166401373
N-[1-[[2-(dimethylamino)-2-phenylacetyl]amino]propan-2-yl]-5-nitro-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 166401373) has the molecular formula C19H23N5O5 and a molecular weight of 401.42 g/mol. Its IUPAC name is N-[1-[[2-(dimethylamino)-2-phenylacetyl]amino]propan-2-yl]-5-nitro-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[1-[[2-(dimethylamino)-2-phenylacetyl]amino]propan-2-yl]-5-nitro-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166401373 |
| Molecular Formula | C19H23N5O5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[1-[[2-(dimethylamino)-2-phenylacetyl]amino]propan-2-yl]-5-nitro-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | CC(CNC(=O)C(c1ccccc1)N(C)C)NC(=O)c1c[nH]c(=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23N5O5/c1-12(22-17(25)14-9-15(24(28)29)18(26)21-11-14)10-20-19(27)16(23(2)3)13-7-5-4-6-8-13/h4-9,11-12,16H,10H2,1-3H3,(H,20,27)(H,21,26)(H,22,25) |
| InChIKey | QYJSMJXGQPMJTP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|