C26H38N8O6S — CID 166401640
N'-[2-[(1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carbonyl)amino]ethyl]-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]oxamide (PubChem CID 166401640) has the molecular formula C26H38N8O6S and a molecular weight of 590.71 g/mol. Its IUPAC name is N'-[2-[(1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carbonyl)amino]ethyl]-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]oxamide.
| Compound Name | N'-[2-[(1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carbonyl)amino]ethyl]-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]oxamide |
|---|---|
| PubChem CID | 166401640 |
| Molecular Formula | C26H38N8O6S |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | N'-[2-[(1-methyl-4-morpholin-4-ylsulfonylpyrrole-2-carbonyl)amino]ethyl]-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]oxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCOCC2)cc1C(=O)NCCNC(=O)C(=O)NCCCN1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C26H38N8O6S/c1-31-20-22(41(38,39)34-15-17-40-18-16-34)19-23(31)24(35)29-8-9-30-26(37)25(36)28-5-2-10-32-11-13-33(14-12-32)21-3-6-27-7-4-21/h3-4,6-7,19-20H,2,5,8-18H2,1H3,(H,28,36)(H,29,35)(H,30,37) |
| InChIKey | OLIMVHDNVDPXGM-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 158.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|