C21H27N5O5S2 — CID 24532534
1-methyl-4-morpholin-4-ylsulfonyl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]pyrrole-2-carboxamide (PubChem CID 24532534) has the molecular formula C21H27N5O5S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 1-methyl-4-morpholin-4-ylsulfonyl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-morpholin-4-ylsulfonyl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 24532534 |
| Molecular Formula | C21H27N5O5S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 1-methyl-4-morpholin-4-ylsulfonyl-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]pyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCOCC2)cc1C(=O)NCCCCCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C21H27N5O5S2/c1-25-15-16(33(28,29)26-9-11-30-12-10-26)14-17(25)21(27)22-8-4-2-3-7-19-23-20(24-31-19)18-6-5-13-32-18/h5-6,13-15H,2-4,7-12H2,1H3,(H,22,27) |
| InChIKey | MXOYSHYEKOBTTO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|