C20H22N2O2S — CID 166403647
N-[[4-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)phenyl]methyl]prop-2-enamide (PubChem CID 166403647) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-[[4-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[4-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166403647 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[[4-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccc(C(=O)N2CCc3sccc3C2CC)cc1 |
| InChI | InChI=1S/C20H22N2O2S/c1-3-17-16-10-12-25-18(16)9-11-22(17)20(24)15-7-5-14(6-8-15)13-21-19(23)4-2/h4-8,10,12,17H,2-3,9,11,13H2,1H3,(H,21,23) |
| InChIKey | ZFDKHFUJOFBBCA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|