C16H19N3OS — CID 61107490
(3,5-diaminophenyl)-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone (PubChem CID 61107490) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is (3,5-diaminophenyl)-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone.
| Compound Name | (3,5-diaminophenyl)-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 61107490 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (3,5-diaminophenyl)-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone |
| SMILES | CCC1c2ccsc2CCN1C(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C16H19N3OS/c1-2-14-13-4-6-21-15(13)3-5-19(14)16(20)10-7-11(17)9-12(18)8-10/h4,6-9,14H,2-3,5,17-18H2,1H3 |
| InChIKey | YCSWHECJQZHLJJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|