C15H15FN2OS — CID 61293484
(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(2-fluoro-4-pyridinyl)methanone (PubChem CID 61293484) has the molecular formula C15H15FN2OS and a molecular weight of 290.36 g/mol. Its IUPAC name is (4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(2-fluoro-4-pyridinyl)methanone.
| Compound Name | (4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(2-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 61293484 |
| Molecular Formula | C15H15FN2OS |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(2-fluoro-4-pyridinyl)methanone |
| SMILES | CCC1c2ccsc2CCN1C(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C15H15FN2OS/c1-2-12-11-5-8-20-13(11)4-7-18(12)15(19)10-3-6-17-14(16)9-10/h3,5-6,8-9,12H,2,4,7H2,1H3 |
| InChIKey | VDCNTNPLWQADPS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|