C19H26N2O3 — CID 166404416
N-[[4-(4-ethoxy-4-methylpiperidine-1-carbonyl)phenyl]methyl]prop-2-enamide (PubChem CID 166404416) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[[4-(4-ethoxy-4-methylpiperidine-1-carbonyl)phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[4-(4-ethoxy-4-methylpiperidine-1-carbonyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166404416 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[[4-(4-ethoxy-4-methylpiperidine-1-carbonyl)phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccc(C(=O)N2CCC(C)(OCC)CC2)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-4-17(22)20-14-15-6-8-16(9-7-15)18(23)21-12-10-19(3,11-13-21)24-5-2/h4,6-9H,1,5,10-14H2,2-3H3,(H,20,22) |
| InChIKey | HMFJSVCYUZZQFG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|