C19H21N3O4 — CID 166410425
N-[[4-[4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carbonyl]phenyl]methyl]prop-2-enamide (PubChem CID 166410425) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[[4-[4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carbonyl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[4-[4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carbonyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166410425 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[[4-[4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carbonyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccc(C(=O)N2CCC(c3cc(=O)[nH]o3)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O4/c1-2-17(23)20-12-13-3-5-15(6-4-13)19(25)22-9-7-14(8-10-22)16-11-18(24)21-26-16/h2-6,11,14H,1,7-10,12H2,(H,20,23)(H,21,24) |
| InChIKey | HIQZAWWKNQQDQI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|