C9H13N3OS — CID 166405074
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 166405074) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 166405074 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1nnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C9H13N3OS/c1-5-6(13)10-8-12-11-7(14-8)9(2,3)4/h5H,1H2,2-4H3,(H,10,12,13) |
| InChIKey | FTPGJVXBTMLRCG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|