C19H19FN4O4 — CID 166405357
4-[2-fluoro-4-[3-(prop-2-enoylamino)propanoylamino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 166405357) has the molecular formula C19H19FN4O4 and a molecular weight of 386.38 g/mol. Its IUPAC name is 4-[2-fluoro-4-[3-(prop-2-enoylamino)propanoylamino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[2-fluoro-4-[3-(prop-2-enoylamino)propanoylamino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 166405357 |
| Molecular Formula | C19H19FN4O4 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-[2-fluoro-4-[3-(prop-2-enoylamino)propanoylamino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | C=CC(=O)NCCC(=O)Nc1ccc(Oc2ccnc(C(=O)NC)c2)c(F)c1 |
| InChI | InChI=1S/C19H19FN4O4/c1-3-17(25)23-9-7-18(26)24-12-4-5-16(14(20)10-12)28-13-6-8-22-15(11-13)19(27)21-2/h3-6,8,10-11H,1,7,9H2,2H3,(H,21,27)(H,23,25)(H,24,26) |
| InChIKey | DOAYYMCEUBAOPT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|