C22H29N3O3 — CID 166405931
1-ethyl-4-(4-phenyl-1-prop-2-enoylpiperidine-4-carbonyl)-1,4-diazepan-2-one (PubChem CID 166405931) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-ethyl-4-(4-phenyl-1-prop-2-enoylpiperidine-4-carbonyl)-1,4-diazepan-2-one.
| Compound Name | 1-ethyl-4-(4-phenyl-1-prop-2-enoylpiperidine-4-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 166405931 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1-ethyl-4-(4-phenyl-1-prop-2-enoylpiperidine-4-carbonyl)-1,4-diazepan-2-one |
| SMILES | C=CC(=O)N1CCC(C(=O)N2CCCN(CC)C(=O)C2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O3/c1-3-19(26)24-15-11-22(12-16-24,18-9-6-5-7-10-18)21(28)25-14-8-13-23(4-2)20(27)17-25/h3,5-7,9-10H,1,4,8,11-17H2,2H3 |
| InChIKey | UGHOYPRJFQFWIW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|