C20H26N2O4S — CID 166407399
1-[4-[(2S)-2-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl]-4-phenylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 166407399) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-[4-[(2S)-2-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl]-4-phenylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[(2S)-2-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl]-4-phenylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166407399 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[4-[(2S)-2-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl]-4-phenylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C(=O)N2CCS(=O)(=O)[C@@H](C)C2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H26N2O4S/c1-3-18(23)21-11-9-20(10-12-21,17-7-5-4-6-8-17)19(24)22-13-14-27(25,26)16(2)15-22/h3-8,16H,1,9-15H2,2H3/t16-/m0/s1 |
| InChIKey | JNLLLSMBWRAEAW-INIZCTEOSA-N |
| XLogP | 1.38 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|