C20H21N3O4 — CID 166407190
N-[3-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]phenyl]prop-2-enamide (PubChem CID 166407190) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[3-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166407190 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[3-[4-(furan-2-carbonyl)-1,4-diazepane-1-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C(=O)N2CCCN(C(=O)c3ccco3)CC2)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-2-18(24)21-16-7-3-6-15(14-16)19(25)22-9-5-10-23(12-11-22)20(26)17-8-4-13-27-17/h2-4,6-8,13-14H,1,5,9-12H2,(H,21,24) |
| InChIKey | JLPCYJFKYNIBRJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|