C18H20N4O3S — CID 166408639
N-[4-hydroxy-3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]phenyl]prop-2-enamide (PubChem CID 166408639) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[4-hydroxy-3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-hydroxy-3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166408639 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[4-hydroxy-3-[4-(1,3-thiazol-2-yl)-1,4-diazepane-1-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(O)c(C(=O)N2CCCN(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C18H20N4O3S/c1-2-16(24)20-13-4-5-15(23)14(12-13)17(25)21-7-3-8-22(10-9-21)18-19-6-11-26-18/h2,4-6,11-12,23H,1,3,7-10H2,(H,20,24) |
| InChIKey | HVXTUIFAXQPHJZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|