About N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide
N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide (PubChem CID 166415889) has the molecular formula C18H21N3O4
and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide |
| PubChem CID | 166415889 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(O)c(C(=O)N2CCCC3(CCNC3=O)C2)c1 |
| InChI | InChI=1S/C18H21N3O4/c1-2-15(23)20-12-4-5-14(22)13(10-12)16(24)21-9-3-6-18(11-21)7-8-19-17(18)25/h2,4-5,10,22H,1,3,6-9,11H2,(H,19,25)(H,20,23) |
| InChIKey | TUKZNKXMBPBNEA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide?
The IUPAC name of N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide (CID 166415889) is N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide.
What is the SMILES notation for N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide?
The canonical SMILES for N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide is C=CC(=O)Nc1ccc(O)c(C(=O)N2CCCC3(CCNC3=O)C2)c1.
What is the InChIKey of N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide?
The InChIKey is TUKZNKXMBPBNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O4/c1-2-15(23)20-12-4-5-14(22)13(10-12)16(24)21-9-3-6-18(11-21)7-8-19-17(18)25/h2,4-5,10,22H,1,3,6-9,11H2,(H,19,25)(H,20,23).
What are the key properties of N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide?
N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide has a molecular weight of 343.38 g/mol, XLogP of 1.26, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-hydroxy-3-(1-oxo-2,9-diazaspiro[4.5]decane-9-carbonyl)phenyl]prop-2-enamide is sourced from PubChem (CID 166415889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).