C19H25F2N3O2 — CID 166410414
N-[2-[[(2S,3R)-2-(3,4-difluorophenyl)-1-propan-2-ylpyrrolidin-3-yl]amino]-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 166410414) has the molecular formula C19H25F2N3O2 and a molecular weight of 365.42 g/mol. Its IUPAC name is N-[2-[[(2S,3R)-2-(3,4-difluorophenyl)-1-propan-2-ylpyrrolidin-3-yl]amino]-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | N-[2-[[(2S,3R)-2-(3,4-difluorophenyl)-1-propan-2-ylpyrrolidin-3-yl]amino]-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 166410414 |
| Molecular Formula | C19H25F2N3O2 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[2-[[(2S,3R)-2-(3,4-difluorophenyl)-1-propan-2-ylpyrrolidin-3-yl]amino]-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)N[C@@H]1CCN(C(C)C)[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H25F2N3O2/c1-5-18(26)23(4)11-17(25)22-16-8-9-24(12(2)3)19(16)13-6-7-14(20)15(21)10-13/h5-7,10,12,16,19H,1,8-9,11H2,2-4H3,(H,22,25)/t16-,19+/m1/s1 |
| InChIKey | UKGFWBSOMAHZGP-APWZRJJASA-N |
| XLogP | 2.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|