C17H26ClFN2O2S — CID 99799973
(2S,3S)-2-(4-chloro-3-fluorophenyl)-N-(3-methylsulfonylpropyl)-1-propan-2-ylpyrrolidin-3-amine (PubChem CID 99799973) has the molecular formula C17H26ClFN2O2S and a molecular weight of 376.93 g/mol. Its IUPAC name is (2S,3S)-2-(4-chloro-3-fluorophenyl)-N-(3-methylsulfonylpropyl)-1-propan-2-ylpyrrolidin-3-amine.
| Compound Name | (2S,3S)-2-(4-chloro-3-fluorophenyl)-N-(3-methylsulfonylpropyl)-1-propan-2-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 99799973 |
| Molecular Formula | C17H26ClFN2O2S |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (2S,3S)-2-(4-chloro-3-fluorophenyl)-N-(3-methylsulfonylpropyl)-1-propan-2-ylpyrrolidin-3-amine |
| SMILES | CC(C)N1CC[C@H](NCCCS(C)(=O)=O)[C@@H]1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C17H26ClFN2O2S/c1-12(2)21-9-7-16(20-8-4-10-24(3,22)23)17(21)13-5-6-14(18)15(19)11-13/h5-6,11-12,16-17,20H,4,7-10H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | HXJFIINVPIYTIM-IRXDYDNUSA-N |
| XLogP | 3.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|