C13H15ClFNO2 — CID 166410704
2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone (PubChem CID 166410704) has the molecular formula C13H15ClFNO2 and a molecular weight of 271.72 g/mol. Its IUPAC name is 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone.
| Compound Name | 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone |
|---|---|
| PubChem CID | 166410704 |
| Molecular Formula | C13H15ClFNO2 |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone |
| SMILES | O=C(CCl)N1CCOCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15ClFNO2/c14-9-13(17)16-6-8-18-7-5-12(16)10-1-3-11(15)4-2-10/h1-4,12H,5-9H2 |
| InChIKey | ZIRPZDFKVCYOQN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|