About 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone
2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone (PubChem CID 166410704) has the molecular formula C13H15ClFNO2
and a molecular weight of 271.72 g/mol. Its IUPAC name is 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone.
Molecular Properties
| Compound Name | 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone |
| PubChem CID | 166410704 |
| Molecular Formula | C13H15ClFNO2 |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone |
| SMILES | O=C(CCl)N1CCOCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15ClFNO2/c14-9-13(17)16-6-8-18-7-5-12(16)10-1-3-11(15)4-2-10/h1-4,12H,5-9H2 |
| InChIKey | ZIRPZDFKVCYOQN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone?
The IUPAC name of 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone (CID 166410704) is 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone.
What is the SMILES notation for 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone?
The canonical SMILES for 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone is O=C(CCl)N1CCOCCC1c1ccc(F)cc1.
What is the InChIKey of 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone?
The InChIKey is ZIRPZDFKVCYOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClFNO2/c14-9-13(17)16-6-8-18-7-5-12(16)10-1-3-11(15)4-2-10/h1-4,12H,5-9H2.
What are the key properties of 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone?
2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone has a molecular weight of 271.72 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-[5-(4-fluorophenyl)-1,4-oxazepan-4-yl]ethanone is sourced from PubChem (CID 166410704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).