C15H18FNOS — CID 135105038
2-(cyclopropylmethylsulfanyl)-1-[2-(4-fluorophenyl)azetidin-1-yl]ethanone (PubChem CID 135105038) has the molecular formula C15H18FNOS and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-(cyclopropylmethylsulfanyl)-1-[2-(4-fluorophenyl)azetidin-1-yl]ethanone.
| Compound Name | 2-(cyclopropylmethylsulfanyl)-1-[2-(4-fluorophenyl)azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 135105038 |
| Molecular Formula | C15H18FNOS |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-(cyclopropylmethylsulfanyl)-1-[2-(4-fluorophenyl)azetidin-1-yl]ethanone |
| SMILES | O=C(CSCC1CC1)N1CCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FNOS/c16-13-5-3-12(4-6-13)14-7-8-17(14)15(18)10-19-9-11-1-2-11/h3-6,11,14H,1-2,7-10H2 |
| InChIKey | XZCZLJRIACVENR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |