C16H16FN3OS — CID 124749524
1-[(2S)-2-(4-fluorophenyl)azetidin-1-yl]-2-(4-methylpyrimidin-2-yl)sulfanylethanone (PubChem CID 124749524) has the molecular formula C16H16FN3OS and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-[(2S)-2-(4-fluorophenyl)azetidin-1-yl]-2-(4-methylpyrimidin-2-yl)sulfanylethanone.
| Compound Name | 1-[(2S)-2-(4-fluorophenyl)azetidin-1-yl]-2-(4-methylpyrimidin-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 124749524 |
| Molecular Formula | C16H16FN3OS |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-[(2S)-2-(4-fluorophenyl)azetidin-1-yl]-2-(4-methylpyrimidin-2-yl)sulfanylethanone |
| SMILES | Cc1ccnc(SCC(=O)N2CC[C@H]2c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H16FN3OS/c1-11-6-8-18-16(19-11)22-10-15(21)20-9-7-14(20)12-2-4-13(17)5-3-12/h2-6,8,14H,7,9-10H2,1H3/t14-/m0/s1 |
| InChIKey | ASGOAPMJYDKOQX-AWEZNQCLSA-N |
| XLogP | 2.99 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |