C20H18F2N2O2 — CID 166412242
N-[(2,2-difluoro-1-phenylcyclopropyl)methyl]-3-(prop-2-enoylamino)benzamide (PubChem CID 166412242) has the molecular formula C20H18F2N2O2 and a molecular weight of 356.37 g/mol. Its IUPAC name is N-[(2,2-difluoro-1-phenylcyclopropyl)methyl]-3-(prop-2-enoylamino)benzamide.
| Compound Name | N-[(2,2-difluoro-1-phenylcyclopropyl)methyl]-3-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 166412242 |
| Molecular Formula | C20H18F2N2O2 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[(2,2-difluoro-1-phenylcyclopropyl)methyl]-3-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1cccc(C(=O)NCC2(c3ccccc3)CC2(F)F)c1 |
| InChI | InChI=1S/C20H18F2N2O2/c1-2-17(25)24-16-10-6-7-14(11-16)18(26)23-13-19(12-20(19,21)22)15-8-4-3-5-9-15/h2-11H,1,12-13H2,(H,23,26)(H,24,25) |
| InChIKey | UBCZMVVHENDMDG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|