C22H33N5O4 — CID 166412840
tert-butyl N-[(3S,4R)-4-(2-methylpyrazol-3-yl)-1-(1-prop-2-enoylpiperidine-3-carbonyl)pyrrolidin-3-yl]carbamate (PubChem CID 166412840) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-4-(2-methylpyrazol-3-yl)-1-(1-prop-2-enoylpiperidine-3-carbonyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R)-4-(2-methylpyrazol-3-yl)-1-(1-prop-2-enoylpiperidine-3-carbonyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 166412840 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | tert-butyl N-[(3S,4R)-4-(2-methylpyrazol-3-yl)-1-(1-prop-2-enoylpiperidine-3-carbonyl)pyrrolidin-3-yl]carbamate |
| SMILES | C=CC(=O)N1CCCC(C(=O)N2C[C@@H](NC(=O)OC(C)(C)C)[C@H](c3ccnn3C)C2)C1 |
| InChI | InChI=1S/C22H33N5O4/c1-6-19(28)26-11-7-8-15(12-26)20(29)27-13-16(18-9-10-23-25(18)5)17(14-27)24-21(30)31-22(2,3)4/h6,9-10,15-17H,1,7-8,11-14H2,2-5H3,(H,24,30)/t15?,16-,17-/m1/s1 |
| InChIKey | FXSNRLBBZNOKNB-YJEKIOLLSA-N |
| XLogP | 1.66 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|