C17H21ClN4O4 — CID 166413039
1-(2-chloro-5-methoxyphenyl)-3-[(1-prop-2-enoylpiperidine-3-carbonyl)amino]urea (PubChem CID 166413039) has the molecular formula C17H21ClN4O4 and a molecular weight of 380.83 g/mol. Its IUPAC name is 1-(2-chloro-5-methoxyphenyl)-3-[(1-prop-2-enoylpiperidine-3-carbonyl)amino]urea.
| Compound Name | 1-(2-chloro-5-methoxyphenyl)-3-[(1-prop-2-enoylpiperidine-3-carbonyl)amino]urea |
|---|---|
| PubChem CID | 166413039 |
| Molecular Formula | C17H21ClN4O4 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-(2-chloro-5-methoxyphenyl)-3-[(1-prop-2-enoylpiperidine-3-carbonyl)amino]urea |
| SMILES | C=CC(=O)N1CCCC(C(=O)NNC(=O)Nc2cc(OC)ccc2Cl)C1 |
| InChI | InChI=1S/C17H21ClN4O4/c1-3-15(23)22-8-4-5-11(10-22)16(24)20-21-17(25)19-14-9-12(26-2)6-7-13(14)18/h3,6-7,9,11H,1,4-5,8,10H2,2H3,(H,20,24)(H2,19,21,25) |
| InChIKey | PIRVBGRDQBRGAD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|