C18H21ClF3N3O2 — CID 172888242
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[1-(1-prop-2-enoylpiperidin-3-yl)ethyl]urea (PubChem CID 172888242) has the molecular formula C18H21ClF3N3O2 and a molecular weight of 403.83 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[1-(1-prop-2-enoylpiperidin-3-yl)ethyl]urea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[1-(1-prop-2-enoylpiperidin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 172888242 |
| Molecular Formula | C18H21ClF3N3O2 |
| Molecular Weight | 403.83 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[1-(1-prop-2-enoylpiperidin-3-yl)ethyl]urea |
| SMILES | C=CC(=O)N1CCCC(C(C)NC(=O)Nc2cc(C(F)(F)F)ccc2Cl)C1 |
| InChI | InChI=1S/C18H21ClF3N3O2/c1-3-16(26)25-8-4-5-12(10-25)11(2)23-17(27)24-15-9-13(18(20,21)22)6-7-14(15)19/h3,6-7,9,11-12H,1,4-5,8,10H2,2H3,(H2,23,24,27) |
| InChIKey | VVAJOKAOAMFCTF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.83 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|