C19H22Cl2N2O2 — CID 166413068
1-[3-(6,8-dichloro-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 166413068) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is 1-[3-(6,8-dichloro-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-(6,8-dichloro-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166413068 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[3-(6,8-dichloro-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(C(=O)N2CCc3cc(Cl)cc(Cl)c3C2C)C1 |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-3-17(24)22-7-4-5-14(11-22)19(25)23-8-6-13-9-15(20)10-16(21)18(13)12(23)2/h3,9-10,12,14H,1,4-8,11H2,2H3 |
| InChIKey | DXGYQRSIGSFVQT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|