C18H20Cl2N2O2 — CID 166411232
1-[3-(5,7-dichloro-3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 166411232) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is 1-[3-(5,7-dichloro-3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-(5,7-dichloro-3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166411232 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-[3-(5,7-dichloro-3,4-dihydro-1H-isoquinoline-2-carbonyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(C(=O)N2CCc3c(Cl)cc(Cl)cc3C2)C1 |
| InChI | InChI=1S/C18H20Cl2N2O2/c1-2-17(23)21-6-3-4-12(10-21)18(24)22-7-5-15-13(11-22)8-14(19)9-16(15)20/h2,8-9,12H,1,3-7,10-11H2 |
| InChIKey | SPDBOHRVKLZVOD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|